C15H14O5Zn — CID 88663945
4-ethoxy-2-hydroxybenzoic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;zinc (PubChem CID 88663945) has the molecular formula C15H14O5Zn and a molecular weight of 339.66 g/mol. Its IUPAC name is 4-ethoxy-2-hydroxybenzoic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;zinc.
| Compound Name | 4-ethoxy-2-hydroxybenzoic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;zinc |
|---|---|
| PubChem CID | 88663945 |
| Molecular Formula | C15H14O5Zn |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 4-ethoxy-2-hydroxybenzoic acid;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;zinc |
| SMILES | CCOc1ccc(C(=O)O)c(O)c1.[Zn].c1ccc2c(c1)O2 |
| InChI | InChI=1S/C9H10O4.C6H4O.Zn/c1-2-13-6-3-4-7(9(11)12)8(10)5-6;1-2-4-6-5(3-1)7-6;/h3-5,10H,2H2,1H3,(H,11,12);1-4H; |
| InChIKey | IWODGKSVRLWSCA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|