C21H24O7 — CID 150462911
(2,4-dihydroxyphenyl)-[2-hydroxy-4-[2-[2-(2-methylprop-1-enoxy)ethoxy]ethoxy]phenyl]methanone (PubChem CID 150462911) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)-[2-hydroxy-4-[2-[2-(2-methylprop-1-enoxy)ethoxy]ethoxy]phenyl]methanone.
| Compound Name | (2,4-dihydroxyphenyl)-[2-hydroxy-4-[2-[2-(2-methylprop-1-enoxy)ethoxy]ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 150462911 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2,4-dihydroxyphenyl)-[2-hydroxy-4-[2-[2-(2-methylprop-1-enoxy)ethoxy]ethoxy]phenyl]methanone |
| SMILES | CC(C)=COCCOCCOc1ccc(C(=O)c2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C21H24O7/c1-14(2)13-27-8-7-26-9-10-28-16-4-6-18(20(24)12-16)21(25)17-5-3-15(22)11-19(17)23/h3-6,11-13,22-24H,7-10H2,1-2H3 |
| InChIKey | HQDROPPVZGOMTD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|