C16H16O6 — CID 2647186
2-(4-methoxyphenoxy)ethyl 2,4-dihydroxybenzoate (PubChem CID 2647186) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 2,4-dihydroxybenzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 2647186 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 2,4-dihydroxybenzoate |
| SMILES | COc1ccc(OCCOC(=O)c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C16H16O6/c1-20-12-3-5-13(6-4-12)21-8-9-22-16(19)14-7-2-11(17)10-15(14)18/h2-7,10,17-18H,8-9H2,1H3 |
| InChIKey | PRMVHLQGFGLIFJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|