C19H22O7 — CID 19856989
2-[2-(4-methoxyphenoxy)ethoxy]ethyl 2,4-dihydroxy-6-methylbenzoate (PubChem CID 19856989) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenoxy)ethoxy]ethyl 2,4-dihydroxy-6-methylbenzoate.
| Compound Name | 2-[2-(4-methoxyphenoxy)ethoxy]ethyl 2,4-dihydroxy-6-methylbenzoate |
|---|---|
| PubChem CID | 19856989 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[2-(4-methoxyphenoxy)ethoxy]ethyl 2,4-dihydroxy-6-methylbenzoate |
| SMILES | COc1ccc(OCCOCCOC(=O)c2c(C)cc(O)cc2O)cc1 |
| InChI | InChI=1S/C19H22O7/c1-13-11-14(20)12-17(21)18(13)19(22)26-10-8-24-7-9-25-16-5-3-15(23-2)4-6-16/h3-6,11-12,20-21H,7-10H2,1-2H3 |
| InChIKey | NXRQJLTVNCPGQH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|