C16H16O7Zn — CID 67821709
2,6-dihydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid;zinc (PubChem CID 67821709) has the molecular formula C16H16O7Zn and a molecular weight of 385.69 g/mol. Its IUPAC name is 2,6-dihydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid;zinc.
| Compound Name | 2,6-dihydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid;zinc |
|---|---|
| PubChem CID | 67821709 |
| Molecular Formula | C16H16O7Zn |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2,6-dihydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid;zinc |
| SMILES | COc1ccc(OCCOc2cc(O)c(C(=O)O)c(O)c2)cc1.[Zn] |
| InChI | InChI=1S/C16H16O7.Zn/c1-21-10-2-4-11(5-3-10)22-6-7-23-12-8-13(17)15(16(19)20)14(18)9-12;/h2-5,8-9,17-18H,6-7H2,1H3,(H,19,20); |
| InChIKey | BCSBECQFXZCPPK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|