C27H30O9 — CID 161441578
3-tert-butyl-2-hydroxybenzoic acid;2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid (PubChem CID 161441578) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is 3-tert-butyl-2-hydroxybenzoic acid;2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid.
| Compound Name | 3-tert-butyl-2-hydroxybenzoic acid;2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 161441578 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-tert-butyl-2-hydroxybenzoic acid;2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoic acid |
| SMILES | CC(C)(C)c1cccc(C(=O)O)c1O.COc1ccc(OCCOc2ccc(C(=O)O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H16O6.C11H14O3/c1-20-11-2-4-12(5-3-11)21-8-9-22-13-6-7-14(16(18)19)15(17)10-13;1-11(2,3)8-6-4-5-7(9(8)12)10(13)14/h2-7,10,17H,8-9H2,1H3,(H,18,19);4-6,12H,1-3H3,(H,13,14) |
| InChIKey | VZIMBXZXEQEGRG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|