C24H23ClO5 — CID 67746394
4-[2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]propan-2-yl]-2-hydroxybenzoic acid (PubChem CID 67746394) has the molecular formula C24H23ClO5 and a molecular weight of 426.90 g/mol. Its IUPAC name is 4-[2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]propan-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]propan-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 67746394 |
| Molecular Formula | C24H23ClO5 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-[2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]propan-2-yl]-2-hydroxybenzoic acid |
| SMILES | CC(C)(c1ccc(OCCOc2ccc(Cl)cc2)cc1)c1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C24H23ClO5/c1-24(2,17-5-12-21(23(27)28)22(26)15-17)16-3-8-19(9-4-16)29-13-14-30-20-10-6-18(25)7-11-20/h3-12,15,26H,13-14H2,1-2H3,(H,27,28) |
| InChIKey | VTUDVZIXCYKBCM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|