C25H26ClNO5 — CID 22761156
2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]-2-[3-(dimethylamino)phenoxy]propanoic acid (PubChem CID 22761156) has the molecular formula C25H26ClNO5 and a molecular weight of 455.94 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]-2-[3-(dimethylamino)phenoxy]propanoic acid.
| Compound Name | 2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]-2-[3-(dimethylamino)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 22761156 |
| Molecular Formula | C25H26ClNO5 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[4-[2-(4-chlorophenoxy)ethoxy]phenyl]-2-[3-(dimethylamino)phenoxy]propanoic acid |
| SMILES | CN(C)c1cccc(OC(C)(C(=O)O)c2ccc(OCCOc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C25H26ClNO5/c1-25(24(28)29,32-23-6-4-5-20(17-23)27(2)3)18-7-11-21(12-8-18)30-15-16-31-22-13-9-19(26)10-14-22/h4-14,17H,15-16H2,1-3H3,(H,28,29) |
| InChIKey | HYQUSOAXVPYLFG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|