C16H18INO2 — CID 141496983
3-[2-(4-iodophenoxy)ethoxy]-N,N-dimethylaniline (PubChem CID 141496983) has the molecular formula C16H18INO2 and a molecular weight of 383.23 g/mol. Its IUPAC name is 3-[2-(4-iodophenoxy)ethoxy]-N,N-dimethylaniline.
| Compound Name | 3-[2-(4-iodophenoxy)ethoxy]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 141496983 |
| Molecular Formula | C16H18INO2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 3-[2-(4-iodophenoxy)ethoxy]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(OCCOc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C16H18INO2/c1-18(2)14-4-3-5-16(12-14)20-11-10-19-15-8-6-13(17)7-9-15/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | XARSQZSLMFZZDX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|