C18H30NO2Si — CID 71254525
CID 71254525 (PubChem CID 71254525) has the molecular formula C18H30NO2Si and a molecular weight of 320.53 g/mol.
| Compound Name | CID 71254525 |
|---|---|
| PubChem CID | 71254525 |
| Molecular Formula | C18H30NO2Si |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | — |
| SMILES | CCCC(CCC)(CCCOc1cccc(N(C)C)c1)O[Si] |
| InChI | InChI=1S/C18H30NO2Si/c1-5-11-18(21-22,12-6-2)13-8-14-20-17-10-7-9-16(15-17)19(3)4/h7,9-10,15H,5-6,8,11-14H2,1-4H3 |
| InChIKey | ZQOYVQVTIBJDKQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|