C14H26N2O5S — CID 141056778
azanium [5-[3-(dimethylamino)phenoxy]-2-methylpentan-2-yl] sulfate (PubChem CID 141056778) has the molecular formula C14H26N2O5S and a molecular weight of 334.44 g/mol. Its IUPAC name is azanium [5-[3-(dimethylamino)phenoxy]-2-methylpentan-2-yl] sulfate.
| Compound Name | azanium [5-[3-(dimethylamino)phenoxy]-2-methylpentan-2-yl] sulfate |
|---|---|
| PubChem CID | 141056778 |
| Molecular Formula | C14H26N2O5S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | azanium [5-[3-(dimethylamino)phenoxy]-2-methylpentan-2-yl] sulfate |
| SMILES | CN(C)c1cccc(OCCCC(C)(C)OS(=O)(=O)[O-])c1.[NH4+] |
| InChI | InChI=1S/C14H23NO5S.H3N/c1-14(2,20-21(16,17)18)9-6-10-19-13-8-5-7-12(11-13)15(3)4;/h5,7-8,11H,6,9-10H2,1-4H3,(H,16,17,18);1H3 |
| InChIKey | MAMOWAHPZCTVTF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|