C12H20N2O2 — CID 64809356
2-amino-4-[3-(dimethylamino)phenoxy]butan-1-ol (PubChem CID 64809356) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-amino-4-[3-(dimethylamino)phenoxy]butan-1-ol.
| Compound Name | 2-amino-4-[3-(dimethylamino)phenoxy]butan-1-ol |
|---|---|
| PubChem CID | 64809356 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-amino-4-[3-(dimethylamino)phenoxy]butan-1-ol |
| SMILES | CN(C)c1cccc(OCCC(N)CO)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-14(2)11-4-3-5-12(8-11)16-7-6-10(13)9-15/h3-5,8,10,15H,6-7,9,13H2,1-2H3 |
| InChIKey | YTNNSZXDYVUGNJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |