C25H22ClF3O5 — CID 70629579
2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]-2-[4-(trifluoromethyl)phenoxy]propanoic acid (PubChem CID 70629579) has the molecular formula C25H22ClF3O5 and a molecular weight of 494.89 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]-2-[4-(trifluoromethyl)phenoxy]propanoic acid.
| Compound Name | 2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]-2-[4-(trifluoromethyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 70629579 |
| Molecular Formula | C25H22ClF3O5 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]-2-[4-(trifluoromethyl)phenoxy]propanoic acid |
| SMILES | CC(COc1ccc(C(C)(Oc2ccc(C(F)(F)F)cc2)C(=O)O)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClF3O5/c1-16(33-21-13-7-19(26)8-14-21)15-32-20-9-3-17(4-10-20)24(2,23(30)31)34-22-11-5-18(6-12-22)25(27,28)29/h3-14,16H,15H2,1-2H3,(H,30,31) |
| InChIKey | HAZJQINTKRBPRJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |