C23H20Cl2O5 — CID 22761125
2-(4-chlorophenoxy)-2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]acetic acid (PubChem CID 22761125) has the molecular formula C23H20Cl2O5 and a molecular weight of 447.31 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]acetic acid.
| Compound Name | 2-(4-chlorophenoxy)-2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 22761125 |
| Molecular Formula | C23H20Cl2O5 |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-(4-chlorophenoxy)-2-[4-[2-(4-chlorophenoxy)propoxy]phenyl]acetic acid |
| SMILES | CC(COc1ccc(C(Oc2ccc(Cl)cc2)C(=O)O)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2O5/c1-15(29-20-10-4-17(24)5-11-20)14-28-19-8-2-16(3-9-19)22(23(26)27)30-21-12-6-18(25)7-13-21/h2-13,15,22H,14H2,1H3,(H,26,27) |
| InChIKey | QYEIHBSDGPEDCF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |