C12H14ClNO4 — CID 57013683
2-[2-(4-chlorophenoxy)propoxyamino]prop-2-enoic acid (PubChem CID 57013683) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)propoxyamino]prop-2-enoic acid.
| Compound Name | 2-[2-(4-chlorophenoxy)propoxyamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 57013683 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)propoxyamino]prop-2-enoic acid |
| SMILES | C=C(NOCC(C)Oc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C12H14ClNO4/c1-8(7-17-14-9(2)12(15)16)18-11-5-3-10(13)4-6-11/h3-6,8,14H,2,7H2,1H3,(H,15,16) |
| InChIKey | BHJTTZQOESAUQY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|