C13H17NO5 — CID 57093505
2-[2-(4-methoxyphenoxy)propoxyamino]prop-2-enoic acid (PubChem CID 57093505) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenoxy)propoxyamino]prop-2-enoic acid.
| Compound Name | 2-[2-(4-methoxyphenoxy)propoxyamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 57093505 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[2-(4-methoxyphenoxy)propoxyamino]prop-2-enoic acid |
| SMILES | C=C(NOCC(C)Oc1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C13H17NO5/c1-9(8-18-14-10(2)13(15)16)19-12-6-4-11(17-3)5-7-12/h4-7,9,14H,2,8H2,1,3H3,(H,15,16) |
| InChIKey | VONKLVBLQLAJOT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|