C24H26O6 — CID 155443167
[2-[4-(4-methoxyphenyl)phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 155443167) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-(4-methoxyphenyl)phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155443167 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)phenoxy]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)Oc1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H26O6/c1-16(2)23(25)28-14-22(15-29-24(26)17(3)4)30-21-12-8-19(9-13-21)18-6-10-20(27-5)11-7-18/h6-13,22H,1,3,14-15H2,2,4-5H3 |
| InChIKey | GCKABBQNYHVYIZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|