C41H48O9 — CID 101166414
2-[4-[1,1-bis[4-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]phenyl]ethyl]phenoxy]propyl 2-methylprop-2-enoate (PubChem CID 101166414) has the molecular formula C41H48O9 and a molecular weight of 684.83 g/mol. Its IUPAC name is 2-[4-[1,1-bis[4-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]phenyl]ethyl]phenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[1,1-bis[4-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]phenyl]ethyl]phenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101166414 |
| Molecular Formula | C41H48O9 |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 2-[4-[1,1-bis[4-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]phenyl]ethyl]phenoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)Oc1ccc(C(C)(c2ccc(OC(C)COC(=O)C(=C)C)cc2)c2ccc(OC(C)COC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C41H48O9/c1-26(2)38(42)45-23-29(7)48-35-17-11-32(12-18-35)41(10,33-13-19-36(20-14-33)49-30(8)24-46-39(43)27(3)4)34-15-21-37(22-16-34)50-31(9)25-47-40(44)28(5)6/h11-22,29-31H,1,3,5,23-25H2,2,4,6-10H3 |
| InChIKey | GZNOCLKYVOSPKF-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|