C25H26IO3S+ — CID 156684299
[4-[1-(2-iodo-2-methylpropanoyl)oxypropan-2-yloxy]phenyl]-diphenylsulfanium (PubChem CID 156684299) has the molecular formula C25H26IO3S+ and a molecular weight of 533.45 g/mol. Its IUPAC name is [4-[1-(2-iodo-2-methylpropanoyl)oxypropan-2-yloxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[1-(2-iodo-2-methylpropanoyl)oxypropan-2-yloxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 156684299 |
| Molecular Formula | C25H26IO3S+ |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | [4-[1-(2-iodo-2-methylpropanoyl)oxypropan-2-yloxy]phenyl]-diphenylsulfanium |
| SMILES | CC(COC(=O)C(C)(C)I)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26IO3S/c1-19(18-28-24(27)25(2,3)26)29-20-14-16-23(17-15-20)30(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-17,19H,18H2,1-3H3/q+1 |
| InChIKey | FNBLUCROOQZKGR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|