C27H30IO5S+ — CID 156683914
[4-[2-[2-[2-(2-iodopropanoyloxy)ethoxy]ethoxy]ethoxy]phenyl]-diphenylsulfanium (PubChem CID 156683914) has the molecular formula C27H30IO5S+ and a molecular weight of 593.50 g/mol. Its IUPAC name is [4-[2-[2-[2-(2-iodopropanoyloxy)ethoxy]ethoxy]ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[2-[2-(2-iodopropanoyloxy)ethoxy]ethoxy]ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 156683914 |
| Molecular Formula | C27H30IO5S+ |
| Molecular Weight | 593.50 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | [4-[2-[2-[2-(2-iodopropanoyloxy)ethoxy]ethoxy]ethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC(I)C(=O)OCCOCCOCCOc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30IO5S/c1-22(28)27(29)33-21-19-31-17-16-30-18-20-32-23-12-14-26(15-13-23)34(24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-15,22H,16-21H2,1H3/q+1 |
| InChIKey | CKWXHBROAYPBFQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|