C27H28IO4S+ — CID 156684099
[4-[6-(2-iodopropanoyloxy)hexanoyloxy]phenyl]-diphenylsulfanium (PubChem CID 156684099) has the molecular formula C27H28IO4S+ and a molecular weight of 575.49 g/mol. Its IUPAC name is [4-[6-(2-iodopropanoyloxy)hexanoyloxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[6-(2-iodopropanoyloxy)hexanoyloxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 156684099 |
| Molecular Formula | C27H28IO4S+ |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 575.07 |
| IUPAC Name | [4-[6-(2-iodopropanoyloxy)hexanoyloxy]phenyl]-diphenylsulfanium |
| SMILES | CC(I)C(=O)OCCCCCC(=O)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28IO4S/c1-21(28)27(30)31-20-10-4-9-15-26(29)32-22-16-18-25(19-17-22)33(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-3,5-8,11-14,16-19,21H,4,9-10,15,20H2,1H3/q+1 |
| InChIKey | UKXGNJVVTIPZJD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|