C14H15F3O5S — CID 15508960
2-[4-(trifluoromethyl)phenyl]sulfonyloxypropyl 2-methylprop-2-enoate (PubChem CID 15508960) has the molecular formula C14H15F3O5S and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]sulfonyloxypropyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]sulfonyloxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 15508960 |
| Molecular Formula | C14H15F3O5S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]sulfonyloxypropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)OS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3O5S/c1-9(2)13(18)21-8-10(3)22-23(19,20)12-6-4-11(5-7-12)14(15,16)17/h4-7,10H,1,8H2,2-3H3 |
| InChIKey | GTJSMWCWFFKEOU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|