C18H23F3O2 — CID 89477194
[2,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pentan-3-yl] 2-methylprop-2-enoate (PubChem CID 89477194) has the molecular formula C18H23F3O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is [2,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pentan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [2,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pentan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89477194 |
| Molecular Formula | C18H23F3O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [2,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccc(C(F)(F)F)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H23F3O2/c1-11(2)16(22)23-17(12(3)4,13(5)6)14-7-9-15(10-8-14)18(19,20)21/h7-10,12-13H,1H2,2-6H3 |
| InChIKey | DKHMETIQQPQXIK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|