C18H26O2 — CID 89476156
[2,4-dimethyl-3-(4-methylphenyl)pentan-3-yl] 2-methylprop-2-enoate (PubChem CID 89476156) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is [2,4-dimethyl-3-(4-methylphenyl)pentan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [2,4-dimethyl-3-(4-methylphenyl)pentan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89476156 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | [2,4-dimethyl-3-(4-methylphenyl)pentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccc(C)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H26O2/c1-12(2)17(19)20-18(13(3)4,14(5)6)16-10-8-15(7)9-11-16/h8-11,13-14H,1H2,2-7H3 |
| InChIKey | DPTVXKZIWMYYRB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|