C14H17F3O2 — CID 67852922
2,2,2-trifluoroethyl 2-methylprop-2-enoate;1,4-xylene (PubChem CID 67852922) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-methylprop-2-enoate;1,4-xylene.
| Compound Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate;1,4-xylene |
|---|---|
| PubChem CID | 67852922 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate;1,4-xylene |
| SMILES | C=C(C)C(=O)OCC(F)(F)F.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C6H7F3O2/c1-7-3-5-8(2)6-4-7;1-4(2)5(10)11-3-6(7,8)9/h3-6H,1-2H3;1,3H2,2H3 |
| InChIKey | DTTSOCMLPWRIAV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|