C17H17F6NO5 — CID 10993676
bis(2,2,2-trifluoroethyl) 2-[(N,4-dimethylanilino)-methoxymethylidene]propanedioate (PubChem CID 10993676) has the molecular formula C17H17F6NO5 and a molecular weight of 429.31 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-[(N,4-dimethylanilino)-methoxymethylidene]propanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2-[(N,4-dimethylanilino)-methoxymethylidene]propanedioate |
|---|---|
| PubChem CID | 10993676 |
| Molecular Formula | C17H17F6NO5 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-[(N,4-dimethylanilino)-methoxymethylidene]propanedioate |
| SMILES | COC(=C(C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F)N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17F6NO5/c1-10-4-6-11(7-5-10)24(2)13(27-3)12(14(25)28-8-16(18,19)20)15(26)29-9-17(21,22)23/h4-7H,8-9H2,1-3H3 |
| InChIKey | DNNGMMWLYSMUNO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|