C14H14F3NO5 — CID 10871324
1-O-methyl 3-O-(2,2,2-trifluoroethyl) 2-[(4-methylphenyl)carbamoyl]propanedioate (PubChem CID 10871324) has the molecular formula C14H14F3NO5 and a molecular weight of 333.26 g/mol. Its IUPAC name is 1-O-methyl 3-O-(2,2,2-trifluoroethyl) 2-[(4-methylphenyl)carbamoyl]propanedioate.
| Compound Name | 1-O-methyl 3-O-(2,2,2-trifluoroethyl) 2-[(4-methylphenyl)carbamoyl]propanedioate |
|---|---|
| PubChem CID | 10871324 |
| Molecular Formula | C14H14F3NO5 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-O-methyl 3-O-(2,2,2-trifluoroethyl) 2-[(4-methylphenyl)carbamoyl]propanedioate |
| SMILES | COC(=O)C(C(=O)Nc1ccc(C)cc1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C14H14F3NO5/c1-8-3-5-9(6-4-8)18-11(19)10(12(20)22-2)13(21)23-7-14(15,16)17/h3-6,10H,7H2,1-2H3,(H,18,19) |
| InChIKey | XIPDGEBQYGBKOL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|