C20H32N2O3 — CID 101353213
methyl (2S)-2-[[3-ethyl-1-(4-methylanilino)-1-oxopentan-2-yl]amino]-3-methylbutanoate (PubChem CID 101353213) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is methyl (2S)-2-[[3-ethyl-1-(4-methylanilino)-1-oxopentan-2-yl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[3-ethyl-1-(4-methylanilino)-1-oxopentan-2-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 101353213 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | methyl (2S)-2-[[3-ethyl-1-(4-methylanilino)-1-oxopentan-2-yl]amino]-3-methylbutanoate |
| SMILES | CCC(CC)C(N[C@H](C(=O)OC)C(C)C)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-7-15(8-2)18(22-17(13(3)4)20(24)25-6)19(23)21-16-11-9-14(5)10-12-16/h9-13,15,17-18,22H,7-8H2,1-6H3,(H,21,23)/t17-,18?/m0/s1 |
| InChIKey | VJBDCRAXIYTZNQ-ZENAZSQFSA-N |
| XLogP | 3.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |