C33H35N2O3P — CID 98091048
methyl (2S)-2-[[(1S)-1-(2-diphenylphosphanylphenyl)-2-(4-methylanilino)-2-oxoethyl]amino]-3-methylbutanoate (PubChem CID 98091048) has the molecular formula C33H35N2O3P and a molecular weight of 538.63 g/mol. Its IUPAC name is methyl (2S)-2-[[(1S)-1-(2-diphenylphosphanylphenyl)-2-(4-methylanilino)-2-oxoethyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(1S)-1-(2-diphenylphosphanylphenyl)-2-(4-methylanilino)-2-oxoethyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 98091048 |
| Molecular Formula | C33H35N2O3P |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | methyl (2S)-2-[[(1S)-1-(2-diphenylphosphanylphenyl)-2-(4-methylanilino)-2-oxoethyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](N[C@H](C(=O)Nc1ccc(C)cc1)c1ccccc1P(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C33H35N2O3P/c1-23(2)30(33(37)38-4)35-31(32(36)34-25-21-19-24(3)20-22-25)28-17-11-12-18-29(28)39(26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-23,30-31,35H,1-4H3,(H,34,36)/t30-,31-/m0/s1 |
| InChIKey | DDQNGUIWYSMSQT-CONSDPRKSA-N |
| XLogP | 5.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|