C11H12F3NO — CID 141436970
3,3,3-trifluoro-N-methyl-N-(4-methylphenyl)propanamide (PubChem CID 141436970) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-methyl-N-(4-methylphenyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-methyl-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 141436970 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3,3,3-trifluoro-N-methyl-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(N(C)C(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO/c1-8-3-5-9(6-4-8)15(2)10(16)7-11(12,13)14/h3-6H,7H2,1-2H3 |
| InChIKey | PUMJALDKIGNYPP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |