C17H23NO5 — CID 135071381
diethyl 2-[2-(N,4-dimethylanilino)-2-oxoethyl]propanedioate (PubChem CID 135071381) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is diethyl 2-[2-(N,4-dimethylanilino)-2-oxoethyl]propanedioate.
| Compound Name | diethyl 2-[2-(N,4-dimethylanilino)-2-oxoethyl]propanedioate |
|---|---|
| PubChem CID | 135071381 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | diethyl 2-[2-(N,4-dimethylanilino)-2-oxoethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)N(C)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C17H23NO5/c1-5-22-16(20)14(17(21)23-6-2)11-15(19)18(4)13-9-7-12(3)8-10-13/h7-10,14H,5-6,11H2,1-4H3 |
| InChIKey | OQYYBJOGBOUFOZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|