C12H15F6NO5 — CID 11122136
bis(2,2,2-trifluoroethyl) 2-[methoxy-(propan-2-ylamino)methylidene]propanedioate (PubChem CID 11122136) has the molecular formula C12H15F6NO5 and a molecular weight of 367.24 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-[methoxy-(propan-2-ylamino)methylidene]propanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2-[methoxy-(propan-2-ylamino)methylidene]propanedioate |
|---|---|
| PubChem CID | 11122136 |
| Molecular Formula | C12H15F6NO5 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-[methoxy-(propan-2-ylamino)methylidene]propanedioate |
| SMILES | COC(NC(C)C)=C(C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C12H15F6NO5/c1-6(2)19-8(22-3)7(9(20)23-4-11(13,14)15)10(21)24-5-12(16,17)18/h6,19H,4-5H2,1-3H3 |
| InChIKey | FODXKNJSAOZXOK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|