C8H11F3NO4- — CID 140799780
3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoate (PubChem CID 140799780) has the molecular formula C8H11F3NO4- and a molecular weight of 242.17 g/mol. Its IUPAC name is 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoate.
| Compound Name | 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 140799780 |
| Molecular Formula | C8H11F3NO4- |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoate |
| SMILES | CC(C)C(NC(=O)OCC(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C8H12F3NO4/c1-4(2)5(6(13)14)12-7(15)16-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14)/p-1 |
| InChIKey | OUNNJHRACCIFBN-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |