C6H4F9NO2 — CID 71672142
2,2,2-trifluoroethyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate (PubChem CID 71672142) has the molecular formula C6H4F9NO2 and a molecular weight of 293.09 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
|---|---|
| PubChem CID | 71672142 |
| Molecular Formula | C6H4F9NO2 |
| Molecular Weight | 293.09 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
| SMILES | O=C(NC(C(F)(F)F)C(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C6H4F9NO2/c7-4(8,9)1-18-3(17)16-2(5(10,11)12)6(13,14)15/h2H,1H2,(H,16,17) |
| InChIKey | KGMNRLPNUJYTPM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |