C10H10F6N2O6 — CID 88924126
2,2,2-trifluoroethyl 2-oxo-2-[2-[[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]amino]ethylamino]acetate (PubChem CID 88924126) has the molecular formula C10H10F6N2O6 and a molecular weight of 368.19 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-oxo-2-[2-[[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]amino]ethylamino]acetate.
| Compound Name | 2,2,2-trifluoroethyl 2-oxo-2-[2-[[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]amino]ethylamino]acetate |
|---|---|
| PubChem CID | 88924126 |
| Molecular Formula | C10H10F6N2O6 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-oxo-2-[2-[[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]amino]ethylamino]acetate |
| SMILES | O=C(NCCNC(=O)C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C10H10F6N2O6/c11-9(12,13)3-23-7(21)5(19)17-1-2-18-6(20)8(22)24-4-10(14,15)16/h1-4H2,(H,17,19)(H,18,20) |
| InChIKey | HPXIKCGEPMAPCB-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|