C8H14F3N3O2 — CID 115514932
N'-(2-aminoethyl)-N-(4,4,4-trifluorobutyl)oxamide (PubChem CID 115514932) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N-(4,4,4-trifluorobutyl)oxamide.
| Compound Name | N'-(2-aminoethyl)-N-(4,4,4-trifluorobutyl)oxamide |
|---|---|
| PubChem CID | 115514932 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N'-(2-aminoethyl)-N-(4,4,4-trifluorobutyl)oxamide |
| SMILES | NCCNC(=O)C(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O2/c9-8(10,11)2-1-4-13-6(15)7(16)14-5-3-12/h1-5,12H2,(H,13,15)(H,14,16) |
| InChIKey | ZWDUOVNKZCITSX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|