C12H23F3N2O — CID 113327443
6-amino-2-methyl-N-(4,4,4-trifluorobutyl)heptanamide (PubChem CID 113327443) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-amino-2-methyl-N-(4,4,4-trifluorobutyl)heptanamide.
| Compound Name | 6-amino-2-methyl-N-(4,4,4-trifluorobutyl)heptanamide |
|---|---|
| PubChem CID | 113327443 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 6-amino-2-methyl-N-(4,4,4-trifluorobutyl)heptanamide |
| SMILES | CC(N)CCCC(C)C(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O/c1-9(5-3-6-10(2)16)11(18)17-8-4-7-12(13,14)15/h9-10H,3-8,16H2,1-2H3,(H,17,18) |
| InChIKey | FKUVDHADOXNHSO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|