C15H14F10O4 — CID 87083622
[2,2,3,3,4,4,5,5,6,6-decafluoro-7-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate (PubChem CID 87083622) has the molecular formula C15H14F10O4 and a molecular weight of 448.25 g/mol. Its IUPAC name is [2,2,3,3,4,4,5,5,6,6-decafluoro-7-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate.
| Compound Name | [2,2,3,3,4,4,5,5,6,6-decafluoro-7-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87083622 |
| Molecular Formula | C15H14F10O4 |
| Molecular Weight | 448.25 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | [2,2,3,3,4,4,5,5,6,6-decafluoro-7-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(=O)C(=C)C |
| InChI | InChI=1S/C15H14F10O4/c1-7(2)9(26)28-5-11(16,17)13(20,21)15(24,25)14(22,23)12(18,19)6-29-10(27)8(3)4/h1,3,5-6H2,2,4H3 |
| InChIKey | MKNSSKJNKPWXMQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|