C16H11F19O2 — CID 122657841
3,3,4,4,5,5,6,6,7,7,8,8,9,9,11,11,12,12,12-nonadecafluorododecyl 2-methylprop-2-enoate (PubChem CID 122657841) has the molecular formula C16H11F19O2 and a molecular weight of 596.22 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,11,11,12,12,12-nonadecafluorododecyl 2-methylprop-2-enoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,11,11,12,12,12-nonadecafluorododecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122657841 |
| Molecular Formula | C16H11F19O2 |
| Molecular Weight | 596.22 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,11,11,12,12,12-nonadecafluorododecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H11F19O2/c1-6(2)7(36)37-4-3-8(17,18)11(23,24)13(27,28)15(31,32)14(29,30)12(25,26)9(19,20)5-10(21,22)16(33,34)35/h1,3-5H2,2H3 |
| InChIKey | IPSRXRLSWRCEHO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.22 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|