C8H10F4O5S — CID 58079068
1,1,2,2-tetrafluoro-4-(2-methylprop-2-enoyloxy)butane-1-sulfonic acid (PubChem CID 58079068) has the molecular formula C8H10F4O5S and a molecular weight of 294.22 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(2-methylprop-2-enoyloxy)butane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-(2-methylprop-2-enoyloxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58079068 |
| Molecular Formula | C8H10F4O5S |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(2-methylprop-2-enoyloxy)butane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H10F4O5S/c1-5(2)6(13)17-4-3-7(9,10)8(11,12)18(14,15)16/h1,3-4H2,2H3,(H,14,15,16) |
| InChIKey | XCZFCDSCGSCOLG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|