C15H19F7O8S — CID 140614604
1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-(2-methylpropoxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid (PubChem CID 140614604) has the molecular formula C15H19F7O8S and a molecular weight of 492.36 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-(2-methylpropoxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-(2-methylpropoxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 140614604 |
| Molecular Formula | C15H19F7O8S |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-(2-methylpropoxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)OCC(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H19F7O8S/c1-8(2)7-28-11(24)13(14(18,19)20,30-10(23)9(3)4)29-6-5-12(16,17)15(21,22)31(25,26)27/h8H,3,5-7H2,1-2,4H3,(H,25,26,27) |
| InChIKey | HDDPAHUQDSVFOY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|