C17H20F7O8S- — CID 140614641
4-[3-cyclohexyloxy-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate (PubChem CID 140614641) has the molecular formula C17H20F7O8S- and a molecular weight of 517.39 g/mol. Its IUPAC name is 4-[3-cyclohexyloxy-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate.
| Compound Name | 4-[3-cyclohexyloxy-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 140614641 |
| Molecular Formula | C17H20F7O8S- |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 4-[3-cyclohexyloxy-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)OC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C17H21F7O8S/c1-10(2)12(25)32-15(16(20,21)22,13(26)31-11-6-4-3-5-7-11)30-9-8-14(18,19)17(23,24)33(27,28)29/h11H,1,3-9H2,2H3,(H,27,28,29)/p-1 |
| InChIKey | FNWBAOLKPGRGJY-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|