C15H19F7NO7S- — CID 140614347
1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-(propylamino)propan-2-yl]oxypentane-1-sulfonate (PubChem CID 140614347) has the molecular formula C15H19F7NO7S- and a molecular weight of 490.37 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-(propylamino)propan-2-yl]oxypentane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-(propylamino)propan-2-yl]oxypentane-1-sulfonate |
|---|---|
| PubChem CID | 140614347 |
| Molecular Formula | C15H19F7NO7S- |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-[1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxo-3-(propylamino)propan-2-yl]oxypentane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC(OCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)NCCC)C(F)(F)F |
| InChI | InChI=1S/C15H20F7NO7S/c1-4-7-23-11(25)13(14(18,19)20,30-10(24)9(2)3)29-8-5-6-12(16,17)15(21,22)31(26,27)28/h2,4-8H2,1,3H3,(H,23,25)(H,26,27,28)/p-1 |
| InChIKey | POMZGBMKHZEXDH-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|