C14H14F10NO7S- — CID 140613876
5-[3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate (PubChem CID 140613876) has the molecular formula C14H14F10NO7S- and a molecular weight of 530.31 g/mol. Its IUPAC name is 5-[3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate.
| Compound Name | 5-[3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 140613876 |
| Molecular Formula | C14H14F10NO7S- |
| Molecular Weight | 530.31 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 5-[3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
| SMILES | C=C(C(=O)OC(OCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)NCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F10NO7S/c1-3-25-9(27)11(13(20,21)22,32-8(26)7(2)12(17,18)19)31-6-4-5-10(15,16)14(23,24)33(28,29)30/h2-6H2,1H3,(H,25,27)(H,28,29,30)/p-1 |
| InChIKey | SDSXKDZHACCWPJ-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|