C15H16F10NO7S- — CID 140614286
6-[3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate (PubChem CID 140614286) has the molecular formula C15H16F10NO7S- and a molecular weight of 544.34 g/mol. Its IUPAC name is 6-[3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate.
| Compound Name | 6-[3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 140614286 |
| Molecular Formula | C15H16F10NO7S- |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | 6-[3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate |
| SMILES | C=C(C(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)N(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H17F10NO7S/c1-8(13(18,19)20)9(27)33-12(14(21,22)23,10(28)26(2)3)32-7-5-4-6-11(16,17)15(24,25)34(29,30)31/h1,4-7H2,2-3H3,(H,29,30,31)/p-1 |
| InChIKey | KEGGYBWXLYRSQE-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|