C11H10F8NO7S- — CID 140613921
5-[3-amino-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate (PubChem CID 140613921) has the molecular formula C11H10F8NO7S- and a molecular weight of 452.25 g/mol. Its IUPAC name is 5-[3-amino-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate.
| Compound Name | 5-[3-amino-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 140613921 |
| Molecular Formula | C11H10F8NO7S- |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 5-[3-amino-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
| SMILES | C=C(F)C(=O)OC(OCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C11H11F8NO7S/c1-5(12)6(21)27-9(7(20)22,10(15,16)17)26-4-2-3-8(13,14)11(18,19)28(23,24)25/h1-4H2,(H2,20,22)(H,23,24,25)/p-1 |
| InChIKey | RBBWTQZJSRMIKX-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|