C15H17F8O8S- — CID 140614621
1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonate (PubChem CID 140614621) has the molecular formula C15H17F8O8S- and a molecular weight of 509.34 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonate |
|---|---|
| PubChem CID | 140614621 |
| Molecular Formula | C15H17F8O8S- |
| Molecular Weight | 509.34 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonate |
| SMILES | C=C(F)C(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)OCCC)C(F)(F)F |
| InChI | InChI=1S/C15H18F8O8S/c1-3-7-29-11(25)13(14(19,20)21,31-10(24)9(2)16)30-8-5-4-6-12(17,18)15(22,23)32(26,27)28/h2-8H2,1H3,(H,26,27,28)/p-1 |
| InChIKey | KYKGCKHNPZCDSS-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|