C15H18F8NO7S- — CID 140614059
5-[3-(tert-butylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate (PubChem CID 140614059) has the molecular formula C15H18F8NO7S- and a molecular weight of 508.36 g/mol. Its IUPAC name is 5-[3-(tert-butylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate.
| Compound Name | 5-[3-(tert-butylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 140614059 |
| Molecular Formula | C15H18F8NO7S- |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 5-[3-(tert-butylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
| SMILES | C=C(F)C(=O)OC(OCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)NC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H19F8NO7S/c1-8(16)9(25)31-13(14(19,20)21,10(26)24-11(2,3)4)30-7-5-6-12(17,18)15(22,23)32(27,28)29/h1,5-7H2,2-4H3,(H,24,26)(H,27,28,29)/p-1 |
| InChIKey | LDXPFHNHPBJXLO-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|