C14H16F7O8S- — CID 140613983
1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-methoxy-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxyhexane-1-sulfonate (PubChem CID 140613983) has the molecular formula C14H16F7O8S- and a molecular weight of 477.33 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-methoxy-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxyhexane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-methoxy-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxyhexane-1-sulfonate |
|---|---|
| PubChem CID | 140613983 |
| Molecular Formula | C14H16F7O8S- |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-methoxy-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxyhexane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C14H17F7O8S/c1-8(2)9(22)29-12(10(23)27-3,13(17,18)19)28-7-5-4-6-11(15,16)14(20,21)30(24,25)26/h1,4-7H2,2-3H3,(H,24,25,26)/p-1 |
| InChIKey | ZSSUMPVOZXPPLO-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|