C20H29F7NO7S- — CID 140614738
5-[3-(dibutylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate (PubChem CID 140614738) has the molecular formula C20H29F7NO7S- and a molecular weight of 560.51 g/mol. Its IUPAC name is 5-[3-(dibutylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate.
| Compound Name | 5-[3-(dibutylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 140614738 |
| Molecular Formula | C20H29F7NO7S- |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 5-[3-(dibutylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC(OCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)N(CCCC)CCCC)C(F)(F)F |
| InChI | InChI=1S/C20H30F7NO7S/c1-5-7-11-28(12-8-6-2)16(30)18(19(23,24)25,35-15(29)14(3)4)34-13-9-10-17(21,22)20(26,27)36(31,32)33/h3,5-13H2,1-2,4H3,(H,31,32,33)/p-1 |
| InChIKey | DOUFKIQFQMNQJR-UHFFFAOYSA-M |
| XLogP | 4.36 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|